C14H19N5O5 — CID 135936918
acetic acid;2-amino-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one (PubChem CID 135936918) has the molecular formula C14H19N5O5 and a molecular weight of 337.34 g/mol. Its IUPAC name is acetic acid;2-amino-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one.
| Compound Name | acetic acid;2-amino-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135936918 |
| Molecular Formula | C14H19N5O5 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | acetic acid;2-amino-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one |
| SMILES | C=C1[C@H](CO)[C@@H](O)C[C@@H]1n1cnc2c(=O)[nH]c(N)nc21.CC(=O)O |
| InChI | InChI=1S/C12H15N5O3.C2H4O2/c1-5-6(3-18)8(19)2-7(5)17-4-14-9-10(17)15-12(13)16-11(9)20;1-2(3)4/h4,6-8,18-19H,1-3H2,(H3,13,15,16,20);1H3,(H,3,4)/t6-,7-,8-;/m0./s1 |
| InChIKey | UEVFFHMOYYYJCS-WQYNNSOESA-N |
| XLogP | -0.74 |
| TPSA | 167.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|