C15H21N5O3 — CID 136950687
2-amino-9-[(1S,3R,4S)-4-hydroxy-2-methylidene-3-(propan-2-yloxymethyl)cyclopentyl]-1H-purin-6-one (PubChem CID 136950687) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-amino-9-[(1S,3R,4S)-4-hydroxy-2-methylidene-3-(propan-2-yloxymethyl)cyclopentyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1S,3R,4S)-4-hydroxy-2-methylidene-3-(propan-2-yloxymethyl)cyclopentyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136950687 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-amino-9-[(1S,3R,4S)-4-hydroxy-2-methylidene-3-(propan-2-yloxymethyl)cyclopentyl]-1H-purin-6-one |
| SMILES | C=C1[C@H](COC(C)C)[C@@H](O)C[C@@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C15H21N5O3/c1-7(2)23-5-9-8(3)10(4-11(9)21)20-6-17-12-13(20)18-15(16)19-14(12)22/h6-7,9-11,21H,3-5H2,1-2H3,(H3,16,18,19,22)/t9-,10-,11-/m0/s1 |
| InChIKey | FUNJDFCJRJZJCI-DCAQKATOSA-N |
| XLogP | 0.60 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|