C20H21N5O4 — CID 172874175
[3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methyl 2-phenylacetate (PubChem CID 172874175) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is [3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methyl 2-phenylacetate.
| Compound Name | [3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methyl 2-phenylacetate |
|---|---|
| PubChem CID | 172874175 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | [3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methyl 2-phenylacetate |
| SMILES | C=C1C(COC(=O)Cc2ccccc2)C(O)CC1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C20H21N5O4/c1-11-13(9-29-16(27)7-12-5-3-2-4-6-12)15(26)8-14(11)25-10-22-17-18(25)23-20(21)24-19(17)28/h2-6,10,13-15,26H,1,7-9H2,(H3,21,23,24,28) |
| InChIKey | WWOFWXXAFDTFAD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|