C23H29N6O7P — CID 137002216
ethyl (2R)-2-[[[(1R,3S,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 137002216) has the molecular formula C23H29N6O7P and a molecular weight of 532.49 g/mol. Its IUPAC name is ethyl (2R)-2-[[[(1R,3S,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2R)-2-[[[(1R,3S,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 137002216 |
| Molecular Formula | C23H29N6O7P |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | ethyl (2R)-2-[[[(1R,3S,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C1[C@H](CO[P@@](=O)(N[C@H](C)C(=O)OCC)Oc2ccccc2)[C@@H](O)C[C@@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C23H29N6O7P/c1-4-34-22(32)14(3)28-37(33,36-15-8-6-5-7-9-15)35-11-16-13(2)17(10-18(16)30)29-12-25-19-20(29)26-23(24)27-21(19)31/h5-9,12,14,16-18,30H,2,4,10-11H2,1,3H3,(H,28,33)(H3,24,26,27,31)/t14-,16+,17+,18+,37+/m1/s1 |
| InChIKey | UKABFYFFBJLQIV-QBJWBVCESA-N |
| XLogP | 1.92 |
| TPSA | 183.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|