C25H30N7O7P — CID 156903576
propan-2-yl (2S)-2-[[[(1S,3S,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-1-cyano-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 156903576) has the molecular formula C25H30N7O7P and a molecular weight of 571.53 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1S,3S,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-1-cyano-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1S,3S,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-1-cyano-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156903576 |
| Molecular Formula | C25H30N7O7P |
| Molecular Weight | 571.53 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1S,3S,5S)-3-(2-amino-6-oxo-1H-purin-9-yl)-1-cyano-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C1[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C[C@H](O)[C@@]1(C#N)CO[P@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C25H30N7O7P/c1-14(2)38-23(35)16(4)31-40(36,39-17-8-6-5-7-9-17)37-12-25(11-26)15(3)18(10-19(25)33)32-13-28-20-21(32)29-24(27)30-22(20)34/h5-9,13-14,16,18-19,33H,3,10,12H2,1-2,4H3,(H,31,36)(H3,27,29,30,34)/t16-,18-,19-,25-,40+/m0/s1 |
| InChIKey | SLBTTXXVZAOPNF-PIOYACNGSA-N |
| XLogP | 2.21 |
| TPSA | 207.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|