C25H32FN6O6P — CID 156903586
propan-2-yl (2S)-2-[[[(1S,3S,5S)-3-(6-aminopurin-9-yl)-1-(fluoromethyl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 156903586) has the molecular formula C25H32FN6O6P and a molecular weight of 562.54 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1S,3S,5S)-3-(6-aminopurin-9-yl)-1-(fluoromethyl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1S,3S,5S)-3-(6-aminopurin-9-yl)-1-(fluoromethyl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156903586 |
| Molecular Formula | C25H32FN6O6P |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1S,3S,5S)-3-(6-aminopurin-9-yl)-1-(fluoromethyl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C1[C@@H](n2cnc3c(N)ncnc32)C[C@H](O)[C@@]1(CF)COP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C25H32FN6O6P/c1-15(2)37-24(34)17(4)31-39(35,38-18-8-6-5-7-9-18)36-12-25(11-26)16(3)19(10-20(25)33)32-14-30-21-22(27)28-13-29-23(21)32/h5-9,13-15,17,19-20,33H,3,10-12H2,1-2,4H3,(H,31,35)(H2,27,28,29)/t17-,19-,20-,25-,39?/m0/s1 |
| InChIKey | NMIODTBVXXQTMR-FKXFNLSCSA-N |
| XLogP | 3.36 |
| TPSA | 163.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|