C24H31N6O7P — CID 139294414
propan-2-yl (2S)-2-[[[(1R,2S,3R,4S,5R)-3-(6-aminopurin-9-yl)-1,2-dihydroxy-4-methyl-6-bicyclo[3.1.0]hexanyl]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 139294414) has the molecular formula C24H31N6O7P and a molecular weight of 546.52 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1R,2S,3R,4S,5R)-3-(6-aminopurin-9-yl)-1,2-dihydroxy-4-methyl-6-bicyclo[3.1.0]hexanyl]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1R,2S,3R,4S,5R)-3-(6-aminopurin-9-yl)-1,2-dihydroxy-4-methyl-6-bicyclo[3.1.0]hexanyl]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 139294414 |
| Molecular Formula | C24H31N6O7P |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1R,2S,3R,4S,5R)-3-(6-aminopurin-9-yl)-1,2-dihydroxy-4-methyl-6-bicyclo[3.1.0]hexanyl]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@@](=O)(Oc1ccccc1)OC1[C@H]2[C@H](C)[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@]12O |
| InChI | InChI=1S/C24H31N6O7P/c1-12(2)35-23(32)14(4)29-38(34,36-15-8-6-5-7-9-15)37-20-16-13(3)18(19(31)24(16,20)33)30-11-28-17-21(25)26-10-27-22(17)30/h5-14,16,18-20,31,33H,1-4H3,(H,29,34)(H2,25,26,27)/t13-,14-,16+,18+,19-,20?,24+,38+/m0/s1 |
| InChIKey | QCLGYCYAOBFIID-UOMZTICPSA-N |
| XLogP | 1.82 |
| TPSA | 183.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|