C29H39N6O10P — CID 66804494
propan-2-yl (2S)-2-[[[(1S)-1-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-di(propanoyloxy)oxolan-2-yl]ethoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 66804494) has the molecular formula C29H39N6O10P and a molecular weight of 662.64 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1S)-1-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-di(propanoyloxy)oxolan-2-yl]ethoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1S)-1-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-di(propanoyloxy)oxolan-2-yl]ethoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 66804494 |
| Molecular Formula | C29H39N6O10P |
| Molecular Weight | 662.64 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1S)-1-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-di(propanoyloxy)oxolan-2-yl]ethoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(=O)O[C@H]1[C@@H](OC(=O)CC)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1[C@H](C)OP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C29H39N6O10P/c1-7-20(36)41-24-23(43-28(25(24)42-21(37)8-2)35-15-33-22-26(30)31-14-32-27(22)35)18(6)44-46(39,45-19-12-10-9-11-13-19)34-17(5)29(38)40-16(3)4/h9-18,23-25,28H,7-8H2,1-6H3,(H,34,39)(H2,30,31,32)/t17-,18-,23+,24+,25+,28+,46?/m0/s1 |
| InChIKey | FOHLLORVKOPQOD-IQWVTKJFSA-N |
| XLogP | 3.47 |
| TPSA | 205.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|