C23H32N7O8P — CID 77169846
propan-2-yl 2-[[1-[5-(2,6-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 77169846) has the molecular formula C23H32N7O8P and a molecular weight of 565.52 g/mol. Its IUPAC name is propan-2-yl 2-[[1-[5-(2,6-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[1-[5-(2,6-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 77169846 |
| Molecular Formula | C23H32N7O8P |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | propan-2-yl 2-[[1-[5-(2,6-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(Oc1ccccc1)OC(C)C1OC(n2cnc3c(N)nc(N)nc32)C(O)C1O |
| InChI | InChI=1S/C23H32N7O8P/c1-11(2)35-22(33)12(3)29-39(34,38-14-8-6-5-7-9-14)37-13(4)18-16(31)17(32)21(36-18)30-10-26-15-19(24)27-23(25)28-20(15)30/h5-13,16-18,21,31-32H,1-4H3,(H,29,34)(H4,24,25,27,28) |
| InChIKey | CRHZSEGCOLPRQH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 219.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|