C31H33N6O8P — CID 66804405
benzyl (2S)-2-[[[(1S)-1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy]-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 66804405) has the molecular formula C31H33N6O8P and a molecular weight of 648.61 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(1S)-1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy]-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(1S)-1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy]-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 66804405 |
| Molecular Formula | C31H33N6O8P |
| Molecular Weight | 648.61 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | benzyl (2S)-2-[[[(1S)-1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy]-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(Oc1cccc2ccccc12)O[C@@H](C)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H33N6O8P/c1-18(31(40)42-15-20-9-4-3-5-10-20)36-46(41,45-23-14-8-12-21-11-6-7-13-22(21)23)44-19(2)27-25(38)26(39)30(43-27)37-17-35-24-28(32)33-16-34-29(24)37/h3-14,16-19,25-27,30,38-39H,15H2,1-2H3,(H,36,41)(H2,32,33,34)/t18-,19-,25-,26+,27+,30+,46?/m0/s1 |
| InChIKey | ITQKTWVFYXCNMH-BYIIXMSKSA-N |
| XLogP | 3.49 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.61 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|