C29H36N7O8P — CID 56932919
cyclohexyl 2-[[1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy-quinolin-5-yloxyphosphoryl]amino]propanoate (PubChem CID 56932919) has the molecular formula C29H36N7O8P and a molecular weight of 641.62 g/mol. Its IUPAC name is cyclohexyl 2-[[1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy-quinolin-5-yloxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy-quinolin-5-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 56932919 |
| Molecular Formula | C29H36N7O8P |
| Molecular Weight | 641.62 g/mol |
| Exact Mass | 641.24 |
| IUPAC Name | cyclohexyl 2-[[1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy-quinolin-5-yloxyphosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(Oc1cccc2ncccc12)OC(C)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C29H36N7O8P/c1-16(29(39)41-18-8-4-3-5-9-18)35-45(40,44-21-12-6-11-20-19(21)10-7-13-31-20)43-17(2)25-23(37)24(38)28(42-25)36-15-34-22-26(30)32-14-33-27(22)36/h6-7,10-18,23-25,28,37-38H,3-5,8-9H2,1-2H3,(H,35,40)(H2,30,32,33)/t16?,17?,23-,24+,25+,28+,45?/m0/s1 |
| InChIKey | VMUFUTNEPKPGGU-YLHIQCPBSA-N |
| XLogP | 3.02 |
| TPSA | 206.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|