C31H35N6O9P — CID 66828333
cyclohexyl 2-[[1-[(4R,6S)-4-(6-aminopurin-9-yl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 66828333) has the molecular formula C31H35N6O9P and a molecular weight of 666.63 g/mol. Its IUPAC name is cyclohexyl 2-[[1-[(4R,6S)-4-(6-aminopurin-9-yl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[1-[(4R,6S)-4-(6-aminopurin-9-yl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 66828333 |
| Molecular Formula | C31H35N6O9P |
| Molecular Weight | 666.63 g/mol |
| Exact Mass | 666.22 |
| IUPAC Name | cyclohexyl 2-[[1-[(4R,6S)-4-(6-aminopurin-9-yl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(Oc1cccc2ccccc12)OC(C)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C2OC(=O)OC21)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C31H35N6O9P/c1-17(30(38)41-20-11-4-3-5-12-20)36-47(40,46-22-14-8-10-19-9-6-7-13-21(19)22)45-18(2)24-25-26(44-31(39)43-25)29(42-24)37-16-35-23-27(32)33-15-34-28(23)37/h6-10,13-18,20,24-26,29H,3-5,11-12H2,1-2H3,(H,36,40)(H2,32,33,34)/t17?,18?,24-,25?,26?,29-,47?/m1/s1 |
| InChIKey | SNKZXXLYECQZCD-HHHIQTIVSA-N |
| XLogP | 4.81 |
| TPSA | 188.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|