C27H35N6O9P — CID 123305515
2,2-dimethylpropyl 2-[[1-[4-(6-aminopurin-9-yl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethoxy-phenoxyphosphoryl]methylamino]propanoate (PubChem CID 123305515) has the molecular formula C27H35N6O9P and a molecular weight of 618.58 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[[1-[4-(6-aminopurin-9-yl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethoxy-phenoxyphosphoryl]methylamino]propanoate.
| Compound Name | 2,2-dimethylpropyl 2-[[1-[4-(6-aminopurin-9-yl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethoxy-phenoxyphosphoryl]methylamino]propanoate |
|---|---|
| PubChem CID | 123305515 |
| Molecular Formula | C27H35N6O9P |
| Molecular Weight | 618.58 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | 2,2-dimethylpropyl 2-[[1-[4-(6-aminopurin-9-yl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethoxy-phenoxyphosphoryl]methylamino]propanoate |
| SMILES | CC(NCP(=O)(Oc1ccccc1)OC(C)C1OC(n2cnc3c(N)ncnc32)C2OC(=O)OC12)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C27H35N6O9P/c1-15(25(34)37-11-27(3,4)5)32-14-43(36,42-17-9-7-6-8-10-17)41-16(2)19-20-21(40-26(35)39-20)24(38-19)33-13-31-18-22(28)29-12-30-23(18)33/h6-10,12-13,15-16,19-21,24,32H,11,14H2,1-5H3,(H2,28,29,30) |
| InChIKey | FBKMRPHDRFUNOP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 188.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|