C32H43N6O10P — CID 66804430
cyclohexyl (2S)-2-[[[(1S)-1-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-di(propanoyloxy)oxolan-2-yl]ethoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 66804430) has the molecular formula C32H43N6O10P and a molecular weight of 702.70 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(1S)-1-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-di(propanoyloxy)oxolan-2-yl]ethoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(1S)-1-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-di(propanoyloxy)oxolan-2-yl]ethoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 66804430 |
| Molecular Formula | C32H43N6O10P |
| Molecular Weight | 702.70 g/mol |
| Exact Mass | 702.28 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(1S)-1-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-di(propanoyloxy)oxolan-2-yl]ethoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(=O)O[C@H]1[C@@H](OC(=O)CC)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1[C@H](C)OP(=O)(N[C@@H](C)C(=O)OC1CCCCC1)Oc1ccccc1 |
| InChI | InChI=1S/C32H43N6O10P/c1-5-23(39)44-27-26(46-31(28(27)45-24(40)6-2)38-18-36-25-29(33)34-17-35-30(25)38)20(4)47-49(42,48-22-15-11-8-12-16-22)37-19(3)32(41)43-21-13-9-7-10-14-21/h8,11-12,15-21,26-28,31H,5-7,9-10,13-14H2,1-4H3,(H,37,42)(H2,33,34,35)/t19-,20-,26+,27+,28+,31+,49?/m0/s1 |
| InChIKey | SWNSTSUHBMXGOF-PVQSFXRJSA-N |
| XLogP | 4.40 |
| TPSA | 205.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|