C27H37N6O8P — CID 56932866
cyclohexyl 2-[[1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy-(2-methylphenoxy)phosphoryl]amino]propanoate (PubChem CID 56932866) has the molecular formula C27H37N6O8P and a molecular weight of 604.60 g/mol. Its IUPAC name is cyclohexyl 2-[[1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy-(2-methylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy-(2-methylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 56932866 |
| Molecular Formula | C27H37N6O8P |
| Molecular Weight | 604.60 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | cyclohexyl 2-[[1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy-(2-methylphenoxy)phosphoryl]amino]propanoate |
| SMILES | Cc1ccccc1OP(=O)(NC(C)C(=O)OC1CCCCC1)OC(C)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H37N6O8P/c1-15-9-7-8-12-19(15)41-42(37,32-16(2)27(36)38-18-10-5-4-6-11-18)40-17(3)23-21(34)22(35)26(39-23)33-14-31-20-24(28)29-13-30-25(20)33/h7-9,12-14,16-18,21-23,26,34-35H,4-6,10-11H2,1-3H3,(H,32,37)(H2,28,29,30)/t16?,17?,21-,22+,23+,26+,42?/m0/s1 |
| InChIKey | UJNRDMKCIXSFGB-VVFNYHACSA-N |
| XLogP | 2.78 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|