C28H38N5O8P — CID 66804620
cyclohexyl 2-[[1-[(2S,3S,4R,5R)-3,4-dihydroxy-5-(6-methylpurin-9-yl)oxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]butanoate (PubChem CID 66804620) has the molecular formula C28H38N5O8P and a molecular weight of 603.61 g/mol. Its IUPAC name is cyclohexyl 2-[[1-[(2S,3S,4R,5R)-3,4-dihydroxy-5-(6-methylpurin-9-yl)oxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]butanoate.
| Compound Name | cyclohexyl 2-[[1-[(2S,3S,4R,5R)-3,4-dihydroxy-5-(6-methylpurin-9-yl)oxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]butanoate |
|---|---|
| PubChem CID | 66804620 |
| Molecular Formula | C28H38N5O8P |
| Molecular Weight | 603.61 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | cyclohexyl 2-[[1-[(2S,3S,4R,5R)-3,4-dihydroxy-5-(6-methylpurin-9-yl)oxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]butanoate |
| SMILES | CCC(NP(=O)(Oc1ccccc1)OC(C)[C@H]1O[C@@H](n2cnc3c(C)ncnc32)[C@H](O)[C@@H]1O)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C28H38N5O8P/c1-4-21(28(36)38-19-11-7-5-8-12-19)32-42(37,41-20-13-9-6-10-14-20)40-18(3)25-23(34)24(35)27(39-25)33-16-31-22-17(2)29-15-30-26(22)33/h6,9-10,13-16,18-19,21,23-25,27,34-35H,4-5,7-8,11-12H2,1-3H3,(H,32,37)/t18?,21?,23-,24+,25+,27+,42?/m0/s1 |
| InChIKey | GPROKHNQSCRCLQ-OEOKZDGZSA-N |
| XLogP | 3.59 |
| TPSA | 167.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|