C27H40N5O6P — CID 176945066
ethane;2-ethylbutyl 2-[[[5-(6-methylpurin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate (PubChem CID 176945066) has the molecular formula C27H40N5O6P and a molecular weight of 561.62 g/mol. Its IUPAC name is ethane;2-ethylbutyl 2-[[[5-(6-methylpurin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate.
| Compound Name | ethane;2-ethylbutyl 2-[[[5-(6-methylpurin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 176945066 |
| Molecular Formula | C27H40N5O6P |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | ethane;2-ethylbutyl 2-[[[5-(6-methylpurin-9-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate |
| SMILES | CC.CCC(CC)COC(=O)CNP(=O)(OCC1CCC(n2cnc3c(C)ncnc32)O1)Oc1ccccc1 |
| InChI | InChI=1S/C25H34N5O6P.C2H6/c1-4-19(5-2)14-33-23(31)13-29-37(32,36-20-9-7-6-8-10-20)34-15-21-11-12-22(35-21)30-17-28-24-18(3)26-16-27-25(24)30;1-2/h6-10,16-17,19,21-22H,4-5,11-15H2,1-3H3,(H,29,32);1-2H3 |
| InChIKey | AHDLOVTWIRUNER-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|