C20H32N3O7P — CID 123588234
butyl 2-[[[5-[(3-amino-3-hydroxypropylidene)amino]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate (PubChem CID 123588234) has the molecular formula C20H32N3O7P and a molecular weight of 457.46 g/mol. Its IUPAC name is butyl 2-[[[5-[(3-amino-3-hydroxypropylidene)amino]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate.
| Compound Name | butyl 2-[[[5-[(3-amino-3-hydroxypropylidene)amino]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 123588234 |
| Molecular Formula | C20H32N3O7P |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | butyl 2-[[[5-[(3-amino-3-hydroxypropylidene)amino]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate |
| SMILES | CCCCOC(=O)CNP(=O)(OCC1CCC(N=CCC(N)O)O1)Oc1ccccc1 |
| InChI | InChI=1S/C20H32N3O7P/c1-2-3-13-27-20(25)14-23-31(26,30-16-7-5-4-6-8-16)28-15-17-9-10-19(29-17)22-12-11-18(21)24/h4-8,12,17-19,24H,2-3,9-11,13-15,21H2,1H3,(H,23,26) |
| InChIKey | IVBCIDNPICOJBG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|