C15H22NO7P — CID 138502301
propyl 2-[[1,3-dioxolan-2-ylmethoxy(phenoxy)phosphoryl]amino]acetate (PubChem CID 138502301) has the molecular formula C15H22NO7P and a molecular weight of 359.32 g/mol. Its IUPAC name is propyl 2-[[1,3-dioxolan-2-ylmethoxy(phenoxy)phosphoryl]amino]acetate.
| Compound Name | propyl 2-[[1,3-dioxolan-2-ylmethoxy(phenoxy)phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 138502301 |
| Molecular Formula | C15H22NO7P |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | propyl 2-[[1,3-dioxolan-2-ylmethoxy(phenoxy)phosphoryl]amino]acetate |
| SMILES | CCCOC(=O)CNP(=O)(OCC1OCCO1)Oc1ccccc1 |
| InChI | InChI=1S/C15H22NO7P/c1-2-8-19-14(17)11-16-24(18,22-12-15-20-9-10-21-15)23-13-6-4-3-5-7-13/h3-7,15H,2,8-12H2,1H3,(H,16,18) |
| InChIKey | BBOZHBDEHULIEZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|