C15H22NO7P — CID 129148836
methyl (2S)-2-[[[(2R)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 129148836) has the molecular formula C15H22NO7P and a molecular weight of 359.32 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 129148836 |
| Molecular Formula | C15H22NO7P |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | methyl (2S)-2-[[[(2R)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@H]1OCCC1O)Oc1ccccc1 |
| InChI | InChI=1S/C15H22NO7P/c1-11(15(18)20-2)16-24(19,23-12-6-4-3-5-7-12)22-10-14-13(17)8-9-21-14/h3-7,11,13-14,17H,8-10H2,1-2H3,(H,16,19)/t11-,13?,14+,24?/m0/s1 |
| InChIKey | HMVUYMSHJBWPNR-YVSRFMJNSA-N |
| XLogP | 1.49 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|