C27H41BNO7P — CID 123713089
CID 123713089 (PubChem CID 123713089) has the molecular formula C27H41BNO7P and a molecular weight of 533.41 g/mol.
| Compound Name | CID 123713089 |
|---|---|
| PubChem CID | 123713089 |
| Molecular Formula | C27H41BNO7P |
| Molecular Weight | 533.41 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | — |
| SMILES | [B]C1OC(COP(=O)(NC(C)C(=O)OC)Oc2ccccc2)C(O)C12CCCCCCC1CC1CCC2 |
| InChI | InChI=1S/C27H41BNO7P/c1-19(25(31)33-2)29-37(32,36-22-13-7-5-8-14-22)34-18-23-24(30)27(26(28)35-23)15-9-4-3-6-11-20-17-21(20)12-10-16-27/h5,7-8,13-14,19-21,23-24,26,30H,3-4,6,9-12,15-18H2,1-2H3,(H,29,32) |
| InChIKey | TXCIMJJYLSNNGP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|