C20H29FN3O7P — CID 174102439
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(aminomethylideneamino)-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 174102439) has the molecular formula C20H29FN3O7P and a molecular weight of 473.44 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(aminomethylideneamino)-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(aminomethylideneamino)-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 174102439 |
| Molecular Formula | C20H29FN3O7P |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(aminomethylideneamino)-4-ethenyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C[C@]1(F)[C@H](N=CN)O[C@H](CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C20H29FN3O7P/c1-5-20(21)17(25)16(30-19(20)23-12-22)11-28-32(27,31-15-9-7-6-8-10-15)24-14(4)18(26)29-13(2)3/h5-10,12-14,16-17,19,25H,1,11H2,2-4H3,(H2,22,23)(H,24,27)/t14-,16+,17+,19+,20+,32-/m0/s1 |
| InChIKey | ZUVVHORFDHYUPE-URBWWBGZSA-N |
| XLogP | 2.09 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|