C19H29FNO6P — CID 90380623
propan-2-yl (2S)-2-[[[(2S,4R,5S)-4-fluoro-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90380623) has the molecular formula C19H29FNO6P and a molecular weight of 417.41 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,4R,5S)-4-fluoro-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,4R,5S)-4-fluoro-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90380623 |
| Molecular Formula | C19H29FNO6P |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,4R,5S)-4-fluoro-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@@](=O)(OC[C@@H]1C[C@@](C)(F)[C@H](C)O1)Oc1ccccc1 |
| InChI | InChI=1S/C19H29FNO6P/c1-13(2)25-18(22)14(3)21-28(23,27-16-9-7-6-8-10-16)24-12-17-11-19(5,20)15(4)26-17/h6-10,13-15,17H,11-12H2,1-5H3,(H,21,23)/t14-,15-,17-,19+,28+/m0/s1 |
| InChIKey | XWSIBEXUHNNOIH-PXPKRVAWSA-N |
| XLogP | 4.03 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|