C20H26N3O9P — CID 59847729
methyl 2-[[[(3R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 59847729) has the molecular formula C20H26N3O9P and a molecular weight of 483.41 g/mol. Its IUPAC name is methyl 2-[[[(3R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl 2-[[[(3R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 59847729 |
| Molecular Formula | C20H26N3O9P |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | methyl 2-[[[(3R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(=O)(OCC1OC(n2cc(C)c(=O)[nH]c2=O)C[C@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C20H26N3O9P/c1-12-10-23(20(27)21-18(12)25)17-9-15(24)16(31-17)11-30-33(28,22-13(2)19(26)29-3)32-14-7-5-4-6-8-14/h4-8,10,13,15-17,24H,9,11H2,1-3H3,(H,22,28)(H,21,25,27)/t13?,15-,16?,17?,33?/m1/s1 |
| InChIKey | YXBWTQJCIYZPPG-ONUDXNPJSA-N |
| XLogP | 0.85 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|