C22H27F3N3O12PS — CID 138470204
methyl 2-[[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate;trifluoromethanesulfonate (PubChem CID 138470204) has the molecular formula C22H27F3N3O12PS and a molecular weight of 645.50 g/mol. Its IUPAC name is methyl 2-[[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate;trifluoromethanesulfonate.
| Compound Name | methyl 2-[[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 138470204 |
| Molecular Formula | C22H27F3N3O12PS |
| Molecular Weight | 645.50 g/mol |
| Exact Mass | 645.10 |
| IUPAC Name | methyl 2-[[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate;trifluoromethanesulfonate |
| SMILES | COC(=O)C(C)NP(=O)(OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H](O)[C@@H]1O)Oc1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C21H26N3O9P.CHF3O3S/c1-13(21(28)30-2)23-34(29,33-15-8-4-3-5-9-15)31-12-16-17(25)18(26)20(32-16)24-10-6-7-14(11-24)19(22)27;2-1(3,4)8(5,6)7/h3-11,13,16-18,20,25-26H,12H2,1-2H3,(H2-,22,23,27,29);(H,5,6,7)/t13?,16-,17-,18-,20-,34?;/m1./s1 |
| InChIKey | ATUIWPYDRQRQKV-QJOVGZQSSA-N |
| XLogP | 0.10 |
| TPSA | 227.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.50 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|