C22H28N2O9P+ — CID 159765456
methyl (2S)-3-[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate (PubChem CID 159765456) has the molecular formula C22H28N2O9P+ and a molecular weight of 495.45 g/mol. Its IUPAC name is methyl (2S)-3-[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate.
| Compound Name | methyl (2S)-3-[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 159765456 |
| Molecular Formula | C22H28N2O9P+ |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | methyl (2S)-3-[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
| SMILES | COC(=O)[C@H](C)CP(=O)(OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H27N2O9P/c1-14(22(28)30-2)13-34(29,33-16-8-4-3-5-9-16)31-12-17-18(25)19(26)21(32-17)24-10-6-7-15(11-24)20(23)27/h3-11,14,17-19,21,25-26H,12-13H2,1-2H3,(H-,23,27)/p+1/t14-,17-,18-,19-,21-,34?/m1/s1 |
| InChIKey | NFLAORALUSDMPQ-SOEBLCLGSA-O |
| XLogP | 0.79 |
| TPSA | 158.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|