C24H32N4O14P+ — CID 161247020
acetic acid;bis[[(3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] phosphate (PubChem CID 161247020) has the molecular formula C24H32N4O14P+ and a molecular weight of 631.51 g/mol. Its IUPAC name is acetic acid;bis[[(3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] phosphate.
| Compound Name | acetic acid;bis[[(3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] phosphate |
|---|---|
| PubChem CID | 161247020 |
| Molecular Formula | C24H32N4O14P+ |
| Molecular Weight | 631.51 g/mol |
| Exact Mass | 631.16 |
| IUPAC Name | acetic acid;bis[[(3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] phosphate |
| SMILES | CC(=O)O.NC(=O)c1ccc[n+]([C@@H]2OC(COP(=O)([O-])OCC3O[C@@H]([n+]4cccc(C(N)=O)c4)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C22H27N4O12P.C2H4O2/c23-19(31)11-3-1-5-25(7-11)21-17(29)15(27)13(37-21)9-35-39(33,34)36-10-14-16(28)18(30)22(38-14)26-6-2-4-12(8-26)20(24)32;1-2(3)4/h1-8,13-18,21-22,27-30H,9-10H2,(H3-2,23,24,31,32,33,34);1H3,(H,3,4)/p+1/t13?,14?,15-,16-,17-,18-,21-,22-;/m1./s1 |
| InChIKey | NYOQCHOCGZHDKG-DNLQXHPJSA-O |
| XLogP | -4.01 |
| TPSA | 289.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.51 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|