C24H31N4O13P+2 — CID 146470911
bis[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl acetate (PubChem CID 146470911) has the molecular formula C24H31N4O13P+2 and a molecular weight of 614.50 g/mol. Its IUPAC name is bis[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl acetate.
| Compound Name | bis[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl acetate |
|---|---|
| PubChem CID | 146470911 |
| Molecular Formula | C24H31N4O13P+2 |
| Molecular Weight | 614.50 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | bis[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl acetate |
| SMILES | CC(=O)OP(=O)(OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H](O)[C@@H]1O)OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H29N4O13P/c1-12(29)41-42(36,37-10-15-17(30)19(32)23(39-15)27-6-2-4-13(8-27)21(25)34)38-11-16-18(31)20(33)24(40-16)28-7-3-5-14(9-28)22(26)35/h2-9,15-20,23-24,30-33H,10-11H2,1H3,(H2-2,25,26,34,35)/p+2/t15-,16-,17-,18-,19-,20-,23-,24-/m1/s1 |
| InChIKey | UZCQBFLEDFOIQH-BGSOTBLPSA-P |
| XLogP | -2.90 |
| TPSA | 255.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.50 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|