C14H20ClN3O6 — CID 158614591
[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-aminopropanoate chloride (PubChem CID 158614591) has the molecular formula C14H20ClN3O6 and a molecular weight of 361.78 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-aminopropanoate chloride.
| Compound Name | [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-aminopropanoate chloride |
|---|---|
| PubChem CID | 158614591 |
| Molecular Formula | C14H20ClN3O6 |
| Molecular Weight | 361.78 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-aminopropanoate chloride |
| SMILES | C[C@H](N)C(=O)OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H](O)[C@@H]1O.[Cl-] |
| InChI | InChI=1S/C14H19N3O6.ClH/c1-7(15)14(21)22-6-9-10(18)11(19)13(23-9)17-4-2-3-8(5-17)12(16)20;/h2-5,7,9-11,13,18-19H,6,15H2,1H3,(H-,16,20);1H/t7-,9+,10+,11+,13+;/m0./s1 |
| InChIKey | GNWFUCRRCILIKA-XQRCZYIMSA-N |
| XLogP | -5.41 |
| TPSA | 148.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.78 |
| LogP ≤ 5 | -5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|