C14H22N2O8P+ — CID 130187489
[(2R,3S,4R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphate (PubChem CID 130187489) has the molecular formula C14H22N2O8P+ and a molecular weight of 377.31 g/mol. Its IUPAC name is [(2R,3S,4R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphate.
| Compound Name | [(2R,3S,4R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 130187489 |
| Molecular Formula | C14H22N2O8P+ |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | [(2R,3S,4R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphate |
| SMILES | CC(C)OP(=O)(O)OC[C@H]1OC([n+]2cccc(C(N)=O)c2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H21N2O8P/c1-8(2)24-25(20,21)22-7-10-11(17)12(18)14(23-10)16-5-3-4-9(6-16)13(15)19/h3-6,8,10-12,14,17-18H,7H2,1-2H3,(H2-,15,19,20,21)/p+1/t10-,11-,12-,14?/m1/s1 |
| InChIKey | RWOZVCAEUJTVPA-ZXRVKKJVSA-O |
| XLogP | -0.77 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|