C12H17NO8P+ — CID 157274250
[(2R,4S,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 157274250) has the molecular formula C12H17NO8P+ and a molecular weight of 334.24 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,4S,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 157274250 |
| Molecular Formula | C12H17NO8P+ |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [(2R,4S,5R)-5-(3-acetylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)(O)O)C(O)[C@@H]2O)c1 |
| InChI | InChI=1S/C12H16NO8P/c1-7(14)8-3-2-4-13(5-8)12-11(16)10(15)9(21-12)6-20-22(17,18)19/h2-5,9-12,15-16H,6H2,1H3,(H-,17,18,19)/p+1/t9-,10?,11+,12-/m1/s1 |
| InChIKey | OKXLYEWHVJAEFT-SGUBAKSOSA-O |
| XLogP | -1.09 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|