C19H22N2O10P+ — CID 167641680
methyl 4-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carbonyl]amino]benzoate (PubChem CID 167641680) has the molecular formula C19H22N2O10P+ and a molecular weight of 469.36 g/mol. Its IUPAC name is methyl 4-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 167641680 |
| Molecular Formula | C19H22N2O10P+ |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | methyl 4-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc[n+]([C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]3O)c2)cc1 |
| InChI | InChI=1S/C19H21N2O10P/c1-29-19(25)11-4-6-13(7-5-11)20-17(24)12-3-2-8-21(9-12)18-16(23)15(22)14(31-18)10-30-32(26,27)28/h2-9,14-16,18,22-23H,10H2,1H3,(H2-,20,24,25,26,27,28)/p+1/t14-,15-,16-,18-/m1/s1 |
| InChIKey | LIKFHZQBOGPEKR-YFHUEUNASA-O |
| XLogP | -0.26 |
| TPSA | 175.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|