C18H29N2O11P+2 — CID 146317292
[(2R)-3-carboxy-2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carbonyl]oxypropyl]-trimethylazanium (PubChem CID 146317292) has the molecular formula C18H29N2O11P+2 and a molecular weight of 480.41 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carbonyl]oxypropyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carbonyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 146317292 |
| Molecular Formula | C18H29N2O11P+2 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | [(2R)-3-carboxy-2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carbonyl]oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C18H27N2O11P/c1-20(2,3)9-12(7-14(21)22)30-18(25)11-5-4-6-19(8-11)17-16(24)15(23)13(31-17)10-29-32(26,27)28/h4-6,8,12-13,15-17,23-24H,7,9-10H2,1-3H3,(H-2,21,22,26,27,28)/p+2/t12-,13-,15-,16-,17-/m1/s1 |
| InChIKey | WEHUDGKXIFFBHM-PVTMVUMOSA-P |
| XLogP | -1.59 |
| TPSA | 183.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|