C13H18NO9P — CID 146462888
[(2R,3R,4S,5R)-5-(3-ethoxycarbonylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 146462888) has the molecular formula C13H18NO9P and a molecular weight of 363.26 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(3-ethoxycarbonylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R)-5-(3-ethoxycarbonylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 146462888 |
| Molecular Formula | C13H18NO9P |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(3-ethoxycarbonylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | CCOC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)([O-])O)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C13H18NO9P/c1-2-21-13(17)8-4-3-5-14(6-8)12-11(16)10(15)9(23-12)7-22-24(18,19)20/h3-6,9-12,15-16H,2,7H2,1H3,(H-,18,19,20)/t9-,10+,11+,12-/m1/s1 |
| InChIKey | PROCVAKFTJYDEV-NOOOWODRSA-N |
| XLogP | -1.75 |
| TPSA | 149.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|