C14H20NO9P — CID 146307462
[(2R,3R,4S,5R)-3,4-dihydroxy-5-(3-propoxycarbonylpyridin-1-ium-1-yl)oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 146307462) has the molecular formula C14H20NO9P and a molecular weight of 377.29 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4-dihydroxy-5-(3-propoxycarbonylpyridin-1-ium-1-yl)oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R)-3,4-dihydroxy-5-(3-propoxycarbonylpyridin-1-ium-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 146307462 |
| Molecular Formula | C14H20NO9P |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4-dihydroxy-5-(3-propoxycarbonylpyridin-1-ium-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | CCCOC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)([O-])O)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C14H20NO9P/c1-2-6-22-14(18)9-4-3-5-15(7-9)13-12(17)11(16)10(24-13)8-23-25(19,20)21/h3-5,7,10-13,16-17H,2,6,8H2,1H3,(H-,19,20,21)/t10-,11+,12+,13-/m1/s1 |
| InChIKey | JDBSXLWIPSBJGD-MROQNXINSA-N |
| XLogP | -1.36 |
| TPSA | 149.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|