C11H14NO9P — CID 91746274
[(2S,3R,4S,5S)-5-(3-carboxypyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 91746274) has the molecular formula C11H14NO9P and a molecular weight of 335.21 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-5-(3-carboxypyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2S,3R,4S,5S)-5-(3-carboxypyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 91746274 |
| Molecular Formula | C11H14NO9P |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | [(2S,3R,4S,5S)-5-(3-carboxypyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | O=C(O)c1ccc[n+]([C@H]2O[C@@H](COP(=O)([O-])O)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C11H14NO9P/c13-8-7(5-20-22(17,18)19)21-10(9(8)14)12-3-1-2-6(4-12)11(15)16/h1-4,7-10,13-14H,5H2,(H2-,15,16,17,18,19)/t7-,8-,9-,10-/m0/s1 |
| InChIKey | JOUIQRNQJGXQDC-XKNYDFJKSA-N |
| XLogP | -2.23 |
| TPSA | 160.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|