C11H12Li2NO9P — CID 146256953
dilithium;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonatooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate (PubChem CID 146256953) has the molecular formula C11H12Li2NO9P and a molecular weight of 347.07 g/mol. Its IUPAC name is dilithium;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonatooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate.
| Compound Name | dilithium;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonatooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 146256953 |
| Molecular Formula | C11H12Li2NO9P |
| Molecular Weight | 347.07 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | dilithium;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonatooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
| SMILES | O=C([O-])c1ccc[n+]([C@@H]2O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]2O)c1.[Li+].[Li+] |
| InChI | InChI=1S/C11H14NO9P.2Li/c13-8-7(5-20-22(17,18)19)21-10(9(8)14)12-3-1-2-6(4-12)11(15)16;;/h1-4,7-10,13-14H,5H2,(H2-,15,16,17,18,19);;/q;2*+1/p-2/t7-,8-,9-,10-;;/m1../s1 |
| InChIKey | DIJQMNVWQAXSCZ-XYSQQLOGSA-L |
| XLogP | -10.19 |
| TPSA | 166.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.07 |
| LogP ≤ 5 | -10.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|