C14H22N3O11P — CID 157020844
[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate;[(1S)-1-carboxy-2-hydroxyethyl]azanium (PubChem CID 157020844) has the molecular formula C14H22N3O11P and a molecular weight of 439.31 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate;[(1S)-1-carboxy-2-hydroxyethyl]azanium.
| Compound Name | [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate;[(1S)-1-carboxy-2-hydroxyethyl]azanium |
|---|---|
| PubChem CID | 157020844 |
| Molecular Formula | C14H22N3O11P |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate;[(1S)-1-carboxy-2-hydroxyethyl]azanium |
| SMILES | NC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]2O)c1.[NH3+][C@@H](CO)C(=O)O |
| InChI | InChI=1S/C11H15N2O8P.C3H7NO3/c12-10(16)6-2-1-3-13(4-6)11-9(15)8(14)7(21-11)5-20-22(17,18)19;4-2(1-5)3(6)7/h1-4,7-9,11,14-15H,5H2,(H3-,12,16,17,18,19);2,5H,1,4H2,(H,6,7)/t7-,8-,9-,11-;2-/m10/s1 |
| InChIKey | XTMZMMOCOGTFTJ-FFHQWVQZSA-N |
| XLogP | -5.79 |
| TPSA | 254.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | -5.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|