C22H27N4O10P — CID 170650207
[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate;[1-carboxy-2-(1H-indol-3-yl)ethyl]azanium (PubChem CID 170650207) has the molecular formula C22H27N4O10P and a molecular weight of 538.45 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate;[1-carboxy-2-(1H-indol-3-yl)ethyl]azanium.
| Compound Name | [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate;[1-carboxy-2-(1H-indol-3-yl)ethyl]azanium |
|---|---|
| PubChem CID | 170650207 |
| Molecular Formula | C22H27N4O10P |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate;[1-carboxy-2-(1H-indol-3-yl)ethyl]azanium |
| SMILES | NC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]2O)c1.[NH3+]C(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C11H15N2O8P.C11H12N2O2/c12-10(16)6-2-1-3-13(4-6)11-9(15)8(14)7(21-11)5-20-22(17,18)19;12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,7-9,11,14-15H,5H2,(H3-,12,16,17,18,19);1-4,6,9,13H,5,12H2,(H,14,15)/t7-,8-,9-,11-;/m1./s1 |
| InChIKey | MMPGUCJJCCSOSE-IVOJBTPCSA-N |
| XLogP | -3.06 |
| TPSA | 249.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|