C19H28N3O17P — CID 162348666
bis([(1S)-1,2-dicarboxyethyl]azanium);1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonatooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate (PubChem CID 162348666) has the molecular formula C19H28N3O17P and a molecular weight of 601.41 g/mol. Its IUPAC name is bis([(1S)-1,2-dicarboxyethyl]azanium);1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonatooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate.
| Compound Name | bis([(1S)-1,2-dicarboxyethyl]azanium);1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonatooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 162348666 |
| Molecular Formula | C19H28N3O17P |
| Molecular Weight | 601.41 g/mol |
| Exact Mass | 601.12 |
| IUPAC Name | bis([(1S)-1,2-dicarboxyethyl]azanium);1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonatooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
| SMILES | O=C([O-])c1ccc[n+]([C@@H]2O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]2O)c1.[NH3+][C@@H](CC(=O)O)C(=O)O.[NH3+][C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H14NO9P.2C4H7NO4/c13-8-7(5-20-22(17,18)19)21-10(9(8)14)12-3-1-2-6(4-12)11(15)16;2*5-2(4(8)9)1-3(6)7/h1-4,7-10,13-14H,5H2,(H2-,15,16,17,18,19);2*2H,1,5H2,(H,6,7)(H,8,9)/t7-,8-,9-,10-;2*2-/m100/s1 |
| InChIKey | HZKALMKJHAXADL-IRBMKEQTSA-N |
| XLogP | -7.89 |
| TPSA | 370.60 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.41 |
| LogP ≤ 5 | -7.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|