C16H23N2O10P — CID 146317459
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[3-[2-(trimethylazaniumyl)acetyl]oxycarbonylpyridin-1-ium-1-yl]oxolan-2-yl]methyl phosphate (PubChem CID 146317459) has the molecular formula C16H23N2O10P and a molecular weight of 434.34 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[3-[2-(trimethylazaniumyl)acetyl]oxycarbonylpyridin-1-ium-1-yl]oxolan-2-yl]methyl phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[3-[2-(trimethylazaniumyl)acetyl]oxycarbonylpyridin-1-ium-1-yl]oxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 146317459 |
| Molecular Formula | C16H23N2O10P |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[3-[2-(trimethylazaniumyl)acetyl]oxycarbonylpyridin-1-ium-1-yl]oxolan-2-yl]methyl phosphate |
| SMILES | C[N+](C)(C)CC(=O)OC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C16H23N2O10P/c1-18(2,3)8-12(19)28-16(22)10-5-4-6-17(7-10)15-14(21)13(20)11(27-15)9-26-29(23,24)25/h4-7,11,13-15,20-21H,8-9H2,1-3H3/t11-,13-,14-,15-/m1/s1 |
| InChIKey | HOGQYGBMGHKBLB-NMFUWQPSSA-N |
| XLogP | -3.17 |
| TPSA | 169.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|