C12H17NO9P+ — CID 162496773
methyl 1-[(2R,4R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate (PubChem CID 162496773) has the molecular formula C12H17NO9P+ and a molecular weight of 350.24 g/mol. Its IUPAC name is methyl 1-[(2R,4R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate.
| Compound Name | methyl 1-[(2R,4R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 162496773 |
| Molecular Formula | C12H17NO9P+ |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | methyl 1-[(2R,4R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
| SMILES | COC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)(O)O)[C@H](O)C2O)c1 |
| InChI | InChI=1S/C12H16NO9P/c1-20-12(16)7-3-2-4-13(5-7)11-10(15)9(14)8(22-11)6-21-23(17,18)19/h2-5,8-11,14-15H,6H2,1H3,(H-,17,18,19)/p+1/t8-,9+,10?,11-/m1/s1 |
| InChIKey | FNKBTJVIYDSGAE-KJLIAQIISA-O |
| XLogP | -1.51 |
| TPSA | 146.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|