C14H21NO9P+ — CID 174992040
propyl 1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-[hydroxy(methoxy)phosphoryl]oxyoxolan-2-yl]pyridin-1-ium-3-carboxylate (PubChem CID 174992040) has the molecular formula C14H21NO9P+ and a molecular weight of 378.29 g/mol. Its IUPAC name is propyl 1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-[hydroxy(methoxy)phosphoryl]oxyoxolan-2-yl]pyridin-1-ium-3-carboxylate.
| Compound Name | propyl 1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-[hydroxy(methoxy)phosphoryl]oxyoxolan-2-yl]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 174992040 |
| Molecular Formula | C14H21NO9P+ |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | propyl 1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-[hydroxy(methoxy)phosphoryl]oxyoxolan-2-yl]pyridin-1-ium-3-carboxylate |
| SMILES | CCCOC(=O)c1ccc[n+]([C@@H]2O[C@H](OP(=O)(O)OC)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C14H20NO9P/c1-3-7-22-13(18)9-5-4-6-15(8-9)12-10(16)11(17)14(23-12)24-25(19,20)21-2/h4-6,8,10-12,14,16-17H,3,7H2,1-2H3/p+1/t10-,11+,12+,14+/m0/s1 |
| InChIKey | OQMCZVCUWIBNIP-FMCLSXCISA-O |
| XLogP | -0.12 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|