C18H28NO6+ — CID 170058849
heptyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate (PubChem CID 170058849) has the molecular formula C18H28NO6+ and a molecular weight of 354.42 g/mol. Its IUPAC name is heptyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate.
| Compound Name | heptyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 170058849 |
| Molecular Formula | C18H28NO6+ |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | heptyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
| SMILES | CCCCCCCOC(=O)c1ccc[n+]([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C18H28NO6/c1-2-3-4-5-6-10-24-18(23)13-8-7-9-19(11-13)17-16(22)15(21)14(12-20)25-17/h7-9,11,14-17,20-22H,2-6,10,12H2,1H3/q+1/t14-,15-,16-,17-/m1/s1 |
| InChIKey | RKBOACFNZDMULC-QBPKDAKJSA-N |
| XLogP | 0.71 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|