C27H43N2O6+ — CID 169029616
[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (Z)-hexadec-9-enoate (PubChem CID 169029616) has the molecular formula C27H43N2O6+ and a molecular weight of 491.65 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (Z)-hexadec-9-enoate.
| Compound Name | [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (Z)-hexadec-9-enoate |
|---|---|
| PubChem CID | 169029616 |
| Molecular Formula | C27H43N2O6+ |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (Z)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H42N2O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-23(30)34-20-22-24(31)25(32)27(35-22)29-18-15-16-21(19-29)26(28)33/h7-8,15-16,18-19,22,24-25,27,31-32H,2-6,9-14,17,20H2,1H3,(H-,28,33)/p+1/b8-7-/t22-,24-,25-,27-/m1/s1 |
| InChIKey | LOONSHUKNBPYSK-AZGPPJKRSA-O |
| XLogP | 3.49 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|