C17H19F3N2O10 — CID 137359331
4-[[(2S,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-4-oxobutanoic acid;2,2,2-trifluoroacetate (PubChem CID 137359331) has the molecular formula C17H19F3N2O10 and a molecular weight of 468.34 g/mol. Its IUPAC name is 4-[[(2S,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-4-oxobutanoic acid;2,2,2-trifluoroacetate.
| Compound Name | 4-[[(2S,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-4-oxobutanoic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 137359331 |
| Molecular Formula | C17H19F3N2O10 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 4-[[(2S,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-4-oxobutanoic acid;2,2,2-trifluoroacetate |
| SMILES | NC(=O)c1ccc[n+]([C@@H]2O[C@@H](COC(=O)CCC(=O)O)[C@@H](O)[C@H]2O)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C15H18N2O8.C2HF3O2/c16-14(23)8-2-1-5-17(6-8)15-13(22)12(21)9(25-15)7-24-11(20)4-3-10(18)19;3-2(4,5)1(6)7/h1-2,5-6,9,12-13,15,21-22H,3-4,7H2,(H2-,16,18,19,23);(H,6,7)/t9-,12+,13+,15+;/m0./s1 |
| InChIKey | ZPPSLYBTEQFVBL-SCMUGHGTSA-N |
| XLogP | -2.60 |
| TPSA | 200.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|