C21H33N2O6+ — CID 118561909
[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl decanoate (PubChem CID 118561909) has the molecular formula C21H33N2O6+ and a molecular weight of 409.50 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl decanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl decanoate |
|---|---|
| PubChem CID | 118561909 |
| Molecular Formula | C21H33N2O6+ |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl decanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H32N2O6/c1-2-3-4-5-6-7-8-11-17(24)28-14-16-18(25)19(26)21(29-16)23-12-9-10-15(13-23)20(22)27/h9-10,12-13,16,18-19,21,25-26H,2-8,11,14H2,1H3,(H-,22,27)/p+1/t16-,18-,19-,21-/m1/s1 |
| InChIKey | QZTZCVCSDLMOEN-XLBJILASSA-O |
| XLogP | 1.38 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|