C26H39N2O8+ — CID 130188379
[(3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-di(pentanoyloxy)oxolan-2-yl]methyl pentanoate (PubChem CID 130188379) has the molecular formula C26H39N2O8+ and a molecular weight of 507.60 g/mol. Its IUPAC name is [(3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-di(pentanoyloxy)oxolan-2-yl]methyl pentanoate.
| Compound Name | [(3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-di(pentanoyloxy)oxolan-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 130188379 |
| Molecular Formula | C26H39N2O8+ |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | [(3R,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-di(pentanoyloxy)oxolan-2-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OCC1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H](OC(=O)CCCC)[C@@H]1OC(=O)CCCC |
| InChI | InChI=1S/C26H38N2O8/c1-4-7-12-20(29)33-17-19-23(35-21(30)13-8-5-2)24(36-22(31)14-9-6-3)26(34-19)28-15-10-11-18(16-28)25(27)32/h10-11,15-16,19,23-24,26H,4-9,12-14,17H2,1-3H3,(H-,27,32)/p+1/t19?,23-,24-,26-/m1/s1 |
| InChIKey | JLLGQTFZFKGDQC-CRTBFVIQSA-O |
| XLogP | 2.91 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|