C16H18F3N2O9S+ — CID 166721157
[(2R,3R,4R)-4-acetyloxy-5-(3-carbamoylpyridin-1-ium-1-yl)-2-(trifluoromethylsulfonyloxymethyl)oxolan-3-yl] acetate (PubChem CID 166721157) has the molecular formula C16H18F3N2O9S+ and a molecular weight of 471.39 g/mol. Its IUPAC name is [(2R,3R,4R)-4-acetyloxy-5-(3-carbamoylpyridin-1-ium-1-yl)-2-(trifluoromethylsulfonyloxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R)-4-acetyloxy-5-(3-carbamoylpyridin-1-ium-1-yl)-2-(trifluoromethylsulfonyloxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 166721157 |
| Molecular Formula | C16H18F3N2O9S+ |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | [(2R,3R,4R)-4-acetyloxy-5-(3-carbamoylpyridin-1-ium-1-yl)-2-(trifluoromethylsulfonyloxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](COS(=O)(=O)C(F)(F)F)OC([n+]2cccc(C(N)=O)c2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H17F3N2O9S/c1-8(22)28-12-11(7-27-31(25,26)16(17,18)19)30-15(13(12)29-9(2)23)21-5-3-4-10(6-21)14(20)24/h3-6,11-13,15H,7H2,1-2H3,(H-,20,24)/p+1/t11-,12-,13-,15?/m1/s1 |
| InChIKey | CVYACQYTQGPBIG-OSBVZDBCSA-O |
| XLogP | -0.30 |
| TPSA | 152.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|