C22H29BrN2O10 — CID 171375970
N-ethyl-1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyridin-1-ium-3-carboximidate;hydrobromide (PubChem CID 171375970) has the molecular formula C22H29BrN2O10 and a molecular weight of 561.38 g/mol. Its IUPAC name is N-ethyl-1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyridin-1-ium-3-carboximidate;hydrobromide.
| Compound Name | N-ethyl-1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyridin-1-ium-3-carboximidate;hydrobromide |
|---|---|
| PubChem CID | 171375970 |
| Molecular Formula | C22H29BrN2O10 |
| Molecular Weight | 561.38 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | N-ethyl-1-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyridin-1-ium-3-carboximidate;hydrobromide |
| SMILES | Br.CC/N=C(\[O-])c1ccc[n+](C2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O)c1 |
| InChI | InChI=1S/C22H28N2O10.BrH/c1-6-23-21(29)16-8-7-9-24(10-16)22-20(33-15(5)28)19(32-14(4)27)18(31-13(3)26)17(34-22)11-30-12(2)25;/h7-10,17-20,22H,6,11H2,1-5H3;1H |
| InChIKey | IEPOQWLFNOAXFB-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 153.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.38 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|